testng-parallel
$
npx mdskill add TheBushidoCollective/han/testng-parallelConfigure TestNG parallel execution to accelerate test runs.
- Optimizes test throughput through thread pool and suite settings.
- Integrates with TestNG XML configuration and bash scripting.
- Analyzes test structure to recommend appropriate parallel modes.
- Generates optimized XML configurations for parallel test execution.
SKILL.md
.github/skills/testng-parallelView on GitHub ↗
---
name: testng-parallel
user-invocable: false
description: Use when configuring parallel test execution with TestNG including thread pools, suite configuration, and synchronization.
allowed-tools: [Read, Write, Edit, Bash, Glob, Grep]
---
# TestNG Parallel Execution
Master TestNG parallel test execution including thread pool configuration, suite-level parallelism, method-level parallelism, and thread safety patterns. This skill covers techniques for maximizing test throughput while maintaining test reliability.
## Overview
TestNG supports parallel execution at multiple levels: suite, test, class, and method. Proper parallel configuration can significantly reduce test execution time, but requires careful consideration of thread safety and resource management.
## Parallel Execution Modes
### Suite-Level Parallelism
Run multiple `<test>` tags in parallel:
```xml
<!DOCTYPE suite SYSTEM "https://testng.org/testng-1.0.dtd">
<suite name="Parallel Suite" parallel="tests" thread-count="3">
<test name="Chrome Tests">
<classes>
<class name="com.example.tests.BrowserTest"/>
</classes>
</test>
<test name="Firefox Tests">
<classes>
<class name="com.example.tests.BrowserTest"/>
</classes>
</test>
<test name="Safari Tests">
<classes>
<class name="com.example.tests.BrowserTest"/>
</classes>
</test>
</suite>
```
### Class-Level Parallelism
Run test classes in parallel:
```xml
<!DOCTYPE suite SYSTEM "https://testng.org/testng-1.0.dtd">
<suite name="Parallel Classes" parallel="classes" thread-count="4">
<test name="All Tests">
<classes>
<class name="com.example.tests.UserServiceTest"/>
<class name="com.example.tests.ProductServiceTest"/>
<class name="com.example.tests.OrderServiceTest"/>
<class name="com.example.tests.PaymentServiceTest"/>
</classes>
</test>
</suite>
```
### Method-Level Parallelism
Run test methods in parallel:
```xml
<!DOCTYPE suite SYSTEM "https://testng.org/testng-1.0.dtd">
<suite name="Parallel Methods" parallel="methods" thread-count="5">
<test name="Service Tests">
<classes>
<class name="com.example.tests.IndependentMethodsTest"/>
</classes>
</test>
</suite>
```
### Instance-Level Parallelism
Run test instances in parallel (useful with Factory):
```xml
<!DOCTYPE suite SYSTEM "https://testng.org/testng-1.0.dtd">
<suite name="Parallel Instances" parallel="instances" thread-count="3">
<test name="Factory Tests">
<classes>
<class name="com.example.tests.FactoryGeneratedTest"/>
</classes>
</test>
</suite>
```
## Thread Pool Configuration
### Basic Thread Configuration
```xml
<!DOCTYPE suite SYSTEM "https://testng.org/testng-1.0.dtd">
<suite name="Thread Pool Suite" parallel="methods" thread-count="10">
<!-- Global thread pool configuration -->
<test name="Test Group 1" thread-count="5">
<!-- Override for this specific test -->
<classes>
<class name="com.example.tests.Test1"/>
</classes>
</test>
<test name="Test Group 2">
<!-- Uses suite-level thread-count -->
<classes>
<class name="com.example.tests.Test2"/>
</classes>
</test>
</suite>
```
### Data Provider Parallel Execution
```xml
<!DOCTYPE suite SYSTEM "https://testng.org/testng-1.0.dtd">
<suite name="DataProvider Suite" data-provider-thread-count="20">
<test name="Data Driven Tests">
<classes>
<class name="com.example.tests.ParallelDataProviderTest"/>
</classes>
</test>
</suite>
```
```java
public class ParallelDataProviderTest {
@DataProvider(name = "largeDataSet", parallel = true)
public Object[][] provideLargeDataSet() {
Object[][] data = new Object[100][2];
for (int i = 0; i < 100; i++) {
data[i] = new Object[]{"User" + i, "user" + i + "@example.com"};
}
return data;
}
@Test(dataProvider = "largeDataSet")
public void testWithParallelData(String name, String email) {
System.out.println(Thread.currentThread().getName() + " - Testing: " + name);
// Each data row runs in parallel
}
}
```
## Thread Safety Patterns
### Thread-Local Storage
```java
import org.testng.annotations.*;
public class ThreadLocalTest {
// Thread-local storage for test-specific resources
private static ThreadLocal<WebDriver> driverThread = new ThreadLocal<>();
private static ThreadLocal<String> sessionThread = new ThreadLocal<>();
@BeforeMethod
public void setUp() {
// Initialize thread-local resources
driverThread.set(createWebDriver());
sessionThread.set(generateSessionId());
}
@AfterMethod
public void tearDown() {
// Clean up thread-local resources
WebDriver driver = driverThread.get();
if (driver != null) {
driver.quit();
}
driverThread.remove();
sessionThread.remove();
}
@Test
public void testParallelBrowser() {
WebDriver driver = driverThread.get();
String session = sessionThread.get();
System.out.println("Thread: " + Thread.currentThread().getName() +
" Session: " + session);
// Use thread-local driver
}
private WebDriver createWebDriver() {
// Create browser instance
return new ChromeDriver();
}
private String generateSessionId() {
return UUID.randomUUID().toString();
}
}
```
### Synchronized Shared Resources
```java
import org.testng.annotations.*;
import java.util.concurrent.atomic.AtomicInteger;
import java.util.concurrent.ConcurrentHashMap;
public class SynchronizedResourceTest {
// Thread-safe counter
private static AtomicInteger testCounter = new AtomicInteger(0);
// Thread-safe collection
private static ConcurrentHashMap<String, String> sharedCache = new ConcurrentHashMap<>();
// Lock object for critical sections
private static final Object lock = new Object();
@Test(threadPoolSize = 5, invocationCount = 100)
public void testAtomicOperations() {
int count = testCounter.incrementAndGet();
System.out.println("Test count: " + count);
}
@Test(threadPoolSize = 3, invocationCount = 50)
public void testConcurrentMap() {
String threadName = Thread.currentThread().getName();
sharedCache.put(threadName, String.valueOf(System.currentTimeMillis()));
// Thread-safe without explicit synchronization
}
@Test(threadPoolSize = 2, invocationCount = 10)
public void testSynchronizedBlock() {
synchronized (lock) {
// Critical section - only one thread at a time
performCriticalOperation();
}
}
private void performCriticalOperation() {
// Operations that require exclusive access
}
}
```
### Immutable Test Data
```java
import java.util.Collections;
import java.util.List;
import java.util.Arrays;
public class ImmutableDataTest {
// Immutable test data - inherently thread-safe
private static final List<String> TEST_USERS = Collections.unmodifiableList(
Arrays.asList("user1", "user2", "user3", "user4", "user5")
);
private static final Map<String, String> CONFIG = Collections.unmodifiableMap(
Map.of(
"url", "https://api.example.com",
"timeout", "30000",
"retries", "3"
)
);
@Test(threadPoolSize = 5, invocationCount = 20)
public void testWithImmutableData() {
// Safe to read from multiple threads
int userIndex = ThreadLocalRandom.current().nextInt(TEST_USERS.size());
String user = TEST_USERS.get(userIndex);
String url = CONFIG.get("url");
System.out.println(Thread.currentThread().getName() +
" - User: " + user + ", URL: " + url);
}
}
```
## Test Isolation Patterns
### Independent Test Methods
```java
public class IndependentTestsExample {
// Each test method is completely independent
@Test
public void testFeatureA() {
// Create its own resources
UserService service = new UserService();
User user = service.createUser("testA");
assertNotNull(user);
// Clean up
service.deleteUser(user.getId());
}
@Test
public void testFeatureB() {
// Completely separate from testFeatureA
ProductService service = new ProductService();
Product product = service.createProduct("testB");
assertNotNull(product);
service.deleteProduct(product.getId());
}
@Test
public void testFeatureC() {
// No shared state with other tests
OrderService service = new OrderService();
Order order = service.createOrder();
assertNotNull(order);
service.cancelOrder(order.getId());
}
}
```
### Isolated Database Tests
```java
import org.testng.annotations.*;
public class IsolatedDatabaseTest {
private Connection connection;
private String testSchema;
@BeforeMethod
public void setUp() throws SQLException {
// Create isolated schema for each test
testSchema = "test_" + Thread.currentThread().getId() + "_" + System.currentTimeMillis();
connection = DriverManager.getConnection(DB_URL, USER, PASSWORD);
connection.createStatement().execute("CREATE SCHEMA " + testSchema);
connection.setCatalog(testSchema);
initializeTestData();
}
@AfterMethod
public void tearDown() throws SQLException {
// Drop isolated schema
connection.createStatement().execute("DROP SCHEMA " + testSchema + " CASCADE");
connection.close();
}
@Test
public void testDatabaseOperation1() throws SQLException {
// Operations in isolated schema
PreparedStatement ps = connection.prepareStatement(
"INSERT INTO users (name) VALUES (?)"
);
ps.setString(1, "TestUser1");
ps.executeUpdate();
ResultSet rs = connection.createStatement().executeQuery(
"SELECT COUNT(*) FROM users"
);
rs.next();
assertEquals(rs.getInt(1), 1);
}
@Test
public void testDatabaseOperation2() throws SQLException {
// Completely isolated from testDatabaseOperation1
PreparedStatement ps = connection.prepareStatement(
"INSERT INTO products (name) VALUES (?)"
);
ps.setString(1, "TestProduct");
ps.executeUpdate();
}
private void initializeTestData() throws SQLException {
// Create tables in isolated schema
}
}
```
## Parallel Execution with Dependencies
### Preserving Order Within Groups
```xml
<!DOCTYPE suite SYSTEM "https://testng.org/testng-1.0.dtd">
<suite name="Ordered Parallel" parallel="classes" thread-count="3">
<test name="Ordered Test" preserve-order="true">
<classes>
<!-- Classes run in parallel, methods in order -->
<class name="com.example.tests.OrderedTest1">
<methods>
<include name="step1"/>
<include name="step2"/>
<include name="step3"/>
</methods>
</class>
<class name="com.example.tests.OrderedTest2"/>
</classes>
</test>
</suite>
```
### Group Threading
```xml
<!DOCTYPE suite SYSTEM "https://testng.org/testng-1.0.dtd">
<suite name="Group Threading" parallel="methods" thread-count="4" group-by-instances="true">
<test name="Instance Grouped">
<classes>
<class name="com.example.tests.InstanceGroupTest"/>
</classes>
</test>
</suite>
```
```java
public class InstanceGroupTest {
private String instanceId;
@Factory
public Object[] createInstances() {
return new Object[] {
new InstanceGroupTest("instance1"),
new InstanceGroupTest("instance2"),
new InstanceGroupTest("instance3")
};
}
public InstanceGroupTest() {}
public InstanceGroupTest(String instanceId) {
this.instanceId = instanceId;
}
@Test
public void step1() {
System.out.println(instanceId + " - Step 1");
}
@Test(dependsOnMethods = "step1")
public void step2() {
System.out.println(instanceId + " - Step 2");
}
@Test(dependsOnMethods = "step2")
public void step3() {
System.out.println(instanceId + " - Step 3");
}
}
```
## Performance Optimization
### Optimal Thread Count
```java
public class ThreadCountOptimization {
// Determine optimal thread count based on available resources
public static int getOptimalThreadCount() {
int availableProcessors = Runtime.getRuntime().availableProcessors();
// For CPU-bound tests
int cpuBoundThreads = availableProcessors;
// For I/O-bound tests (network, file, database)
int ioBoundThreads = availableProcessors * 2;
// For mixed workloads
int mixedThreads = (int) (availableProcessors * 1.5);
return mixedThreads;
}
}
```
### Resource Pool Pattern
```java
import java.util.concurrent.*;
public class ResourcePoolTest {
// Connection pool for parallel tests
private static BlockingQueue<Connection> connectionPool;
@BeforeSuite
public void setUpSuite() {
int poolSize = 10;
connectionPool = new ArrayBlockingQueue<>(poolSize);
for (int i = 0; i < poolSize; i++) {
connectionPool.offer(createConnection());
}
}
@AfterSuite
public void tearDownSuite() {
Connection conn;
while ((conn = connectionPool.poll()) != null) {
closeConnection(conn);
}
}
@Test(threadPoolSize = 5, invocationCount = 50)
public void testWithPooledConnection() throws InterruptedException {
Connection conn = connectionPool.take(); // Borrow
try {
// Use connection
performDatabaseOperation(conn);
} finally {
connectionPool.offer(conn); // Return
}
}
private Connection createConnection() {
// Create database connection
return null;
}
private void closeConnection(Connection conn) {
// Close connection
}
private void performDatabaseOperation(Connection conn) {
// Database operations
}
}
```
## Reporting for Parallel Tests
### Custom Reporter for Parallel Execution
```java
import org.testng.*;
import java.util.concurrent.ConcurrentHashMap;
public class ParallelTestReporter implements ITestListener {
private static ConcurrentHashMap<Long, List<String>> threadTestMap =
new ConcurrentHashMap<>();
@Override
public void onTestStart(ITestResult result) {
long threadId = Thread.currentThread().getId();
threadTestMap.computeIfAbsent(threadId, k -> new CopyOnWriteArrayList<>())
.add(result.getName());
}
@Override
public void onFinish(ITestContext context) {
System.out.println("\n=== Thread Distribution Report ===");
threadTestMap.forEach((threadId, tests) -> {
System.out.println("Thread " + threadId + ": " + tests.size() + " tests");
tests.forEach(test -> System.out.println(" - " + test));
});
System.out.println("Total threads used: " + threadTestMap.size());
}
}
```
### Timeout Configuration
```java
public class TimeoutTest {
@Test(timeOut = 5000)
public void testWithTimeout() {
// Fails if takes more than 5 seconds
}
@Test(timeOut = 10000, threadPoolSize = 3, invocationCount = 10)
public void testParallelWithTimeout() {
// Each invocation has 10 second timeout
}
}
```
```xml
<!DOCTYPE suite SYSTEM "https://testng.org/testng-1.0.dtd">
<suite name="Timeout Suite" time-out="60000">
<!-- Suite-level timeout: 60 seconds total -->
<test name="Quick Tests" time-out="10000">
<!-- Test-level timeout: 10 seconds for all tests in this group -->
<classes>
<class name="com.example.tests.QuickTest"/>
</classes>
</test>
</suite>
```
## Best Practices
1. **Design for independence** - Tests should not depend on shared mutable state
2. **Use ThreadLocal for per-thread resources** - Drivers, sessions, connections
3. **Prefer immutable data** - Thread-safe by design
4. **Set appropriate thread counts** - Based on resource availability
5. **Implement proper cleanup** - Prevent resource leaks in parallel execution
6. **Use thread-safe collections** - ConcurrentHashMap, CopyOnWriteArrayList
7. **Configure timeouts** - Prevent hung tests from blocking threads
8. **Monitor thread distribution** - Ensure balanced workload
9. **Test locally first** - Verify thread safety before CI/CD
10. **Document thread safety requirements** - Clear expectations for test authors
## Common Pitfalls
1. **Shared mutable state** - Causes race conditions and flaky tests
2. **Static fields without synchronization** - Not thread-safe
3. **Resource contention** - Too many threads competing for limited resources
4. **Order dependencies** - Tests that assume execution order
5. **Missing cleanup** - ThreadLocal resources not removed
6. **Insufficient isolation** - Database tests affecting each other
7. **Too many threads** - Overhead exceeds benefits
8. **Ignoring timeouts** - Hung tests blocking execution
9. **Non-deterministic failures** - Hard to reproduce parallel issues
10. **Improper connection pooling** - Connection leaks or exhaustion
## When to Use This Skill
- Reducing test suite execution time
- Configuring CI/CD parallel test execution
- Implementing thread-safe test infrastructure
- Designing parallel-friendly test architecture
- Troubleshooting parallel test failures
- Optimizing resource utilization in tests
- Building scalable test frameworks
- Implementing cross-browser parallel testing
More from TheBushidoCollective/han
- absinthe-resolversUse when implementing GraphQL resolvers with Absinthe. Covers resolver patterns, dataloader integration, batching, and error handling.
- absinthe-schemaUse when designing GraphQL schemas with Absinthe. Covers type definitions, interfaces, unions, enums, and schema organization patterns.
- absinthe-subscriptionsUse when implementing real-time GraphQL subscriptions with Absinthe. Covers Phoenix channels, PubSub, and subscription patterns.
- act-docker-setupUse when configuring Docker environments for act, selecting runner images, managing container resources, or troubleshooting Docker-related issues with local GitHub Actions testing.
- act-local-testingUse when testing GitHub Actions workflows locally with act. Covers act CLI usage, Docker configuration, debugging workflows, and troubleshooting common issues when running workflows on your local machine.
- act-workflow-syntaxUse when creating or modifying GitHub Actions workflow files. Provides guidance on workflow syntax, triggers, jobs, steps, and expressions for creating valid GitHub Actions workflows that can be tested locally with act.
- ameba-configurationUse when configuring Ameba rules and settings for Crystal projects including .ameba.yml setup, rule management, severity levels, and code quality enforcement.
- ameba-custom-rulesUse when creating custom Ameba rules for Crystal code analysis including rule development, AST traversal, issue reporting, and rule testing.
- ameba-integrationUse when integrating Ameba into development workflows including CI/CD pipelines, pre-commit hooks, GitHub Actions, and automated code review processes.
- analyze-performanceAnalyze performance metrics and identify slow transactions in Sentry